C26H30N4O2 — CID 110226608
N-[pyridin-2-yl-[1-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide (PubChem CID 110226608) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[pyridin-2-yl-[1-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[pyridin-2-yl-[1-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 110226608 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[pyridin-2-yl-[1-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NC(c1ccccn1)C1CCN(Cc2ccc(OCc3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C26H30N4O2/c1-20(31)29-26(25-7-3-5-15-28-25)22-12-16-30(17-13-22)18-21-8-10-24(11-9-21)32-19-23-6-2-4-14-27-23/h2-11,14-15,22,26H,12-13,16-19H2,1H3,(H,29,31) |
| InChIKey | UDRHPNIGGWDEKH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |