About 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide
1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110232249) has the molecular formula C23H30N2O2S
and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| PubChem CID | 110232249 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCCC(Cc2cccc(-c3cccs3)c2)(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C23H30N2O2S/c1-4-8-21(26)25-13-7-12-23(17-25,22(27)24(2)3)16-18-9-5-10-19(15-18)20-11-6-14-28-20/h5-6,9-11,14-15H,4,7-8,12-13,16-17H2,1-3H3 |
| InChIKey | RNVUHJUFHQJBQX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide?
The IUPAC name of 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (CID 110232249) is 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide?
The canonical SMILES for 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide is CCCC(=O)N1CCCC(Cc2cccc(-c3cccs3)c2)(C(=O)N(C)C)C1.
What is the InChIKey of 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide?
The InChIKey is RNVUHJUFHQJBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O2S/c1-4-8-21(26)25-13-7-12-23(17-25,22(27)24(2)3)16-18-9-5-10-19(15-18)20-11-6-14-28-20/h5-6,9-11,14-15H,4,7-8,12-13,16-17H2,1-3H3.
What are the key properties of 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide?
1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide has a molecular weight of 398.57 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butanoyl-N,N-dimethyl-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide is sourced from PubChem (CID 110232249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).