C21H26N2O2S — CID 92586361
(3S)-1-butanoyl-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 92586361) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (3S)-1-butanoyl-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-butanoyl-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92586361 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (3S)-1-butanoyl-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCC[C@@](Cc2ccc(-c3cccs3)cc2)(C(N)=O)C1 |
| InChI | InChI=1S/C21H26N2O2S/c1-2-5-19(24)23-12-4-11-21(15-23,20(22)25)14-16-7-9-17(10-8-16)18-6-3-13-26-18/h3,6-10,13H,2,4-5,11-12,14-15H2,1H3,(H2,22,25)/t21-/m0/s1 |
| InChIKey | BZUQSDXCZODRES-NRFANRHFSA-N |
| XLogP | 3.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |