C24H25N3O2S — CID 92569671
(3S)-1-(2-pyridin-3-ylacetyl)-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 92569671) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is (3S)-1-(2-pyridin-3-ylacetyl)-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-pyridin-3-ylacetyl)-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92569671 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (3S)-1-(2-pyridin-3-ylacetyl)-3-[(3-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2cccc(-c3cccs3)c2)CCCN(C(=O)Cc2cccnc2)C1 |
| InChI | InChI=1S/C24H25N3O2S/c25-23(29)24(15-18-5-1-7-20(13-18)21-8-3-12-30-21)9-4-11-27(17-24)22(28)14-19-6-2-10-26-16-19/h1-3,5-8,10,12-13,16H,4,9,11,14-15,17H2,(H2,25,29)/t24-/m0/s1 |
| InChIKey | WZJMSXOVCUZLHT-DEOSSOPVSA-N |
| XLogP | 3.69 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |