C23H27N5O3 — CID 110235518
4-(2,4-dimethylphenoxy)-1-[3-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one (PubChem CID 110235518) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-1-[3-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-dimethylphenoxy)-1-[3-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110235518 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-1-[3-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCCC(c3nnc(-c4cnccn4)o3)C2)c(C)c1 |
| InChI | InChI=1S/C23H27N5O3/c1-16-7-8-20(17(2)13-16)30-12-4-6-21(29)28-11-3-5-18(15-28)22-26-27-23(31-22)19-14-24-9-10-25-19/h7-10,13-14,18H,3-6,11-12,15H2,1-2H3 |
| InChIKey | UYNYWBMKODOSHX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|