C19H29NO3 — CID 11023617
methyl (4R)-4-[(3S)-5-oxo-9-propan-2-yl-1,2,3,6,7,8-hexahydropyrrolo[1,2-a]azepin-3-yl]hex-5-enoate (PubChem CID 11023617) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is methyl (4R)-4-[(3S)-5-oxo-9-propan-2-yl-1,2,3,6,7,8-hexahydropyrrolo[1,2-a]azepin-3-yl]hex-5-enoate.
| Compound Name | methyl (4R)-4-[(3S)-5-oxo-9-propan-2-yl-1,2,3,6,7,8-hexahydropyrrolo[1,2-a]azepin-3-yl]hex-5-enoate |
|---|---|
| PubChem CID | 11023617 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | methyl (4R)-4-[(3S)-5-oxo-9-propan-2-yl-1,2,3,6,7,8-hexahydropyrrolo[1,2-a]azepin-3-yl]hex-5-enoate |
| SMILES | C=C[C@@H](CCC(=O)OC)[C@@H]1CCC2=C(C(C)C)CCCC(=O)N21 |
| InChI | InChI=1S/C19H29NO3/c1-5-14(9-12-19(22)23-4)16-10-11-17-15(13(2)3)7-6-8-18(21)20(16)17/h5,13-14,16H,1,6-12H2,2-4H3/t14-,16-/m0/s1 |
| InChIKey | VMUUXULDWHOKTC-HOCLYGCPSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|