C15H21NO3 — CID 11391394
methyl 2-[(4R,5S,8R,13R)-2-oxo-1-azatricyclo[6.4.1.04,13]tridec-6-en-5-yl]acetate (PubChem CID 11391394) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl 2-[(4R,5S,8R,13R)-2-oxo-1-azatricyclo[6.4.1.04,13]tridec-6-en-5-yl]acetate.
| Compound Name | methyl 2-[(4R,5S,8R,13R)-2-oxo-1-azatricyclo[6.4.1.04,13]tridec-6-en-5-yl]acetate |
|---|---|
| PubChem CID | 11391394 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl 2-[(4R,5S,8R,13R)-2-oxo-1-azatricyclo[6.4.1.04,13]tridec-6-en-5-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@H]2CCCCN3C(=O)C[C@H]1[C@@H]23 |
| InChI | InChI=1S/C15H21NO3/c1-19-14(18)8-11-6-5-10-4-2-3-7-16-13(17)9-12(11)15(10)16/h5-6,10-12,15H,2-4,7-9H2,1H3/t10-,11-,12-,15-/m1/s1 |
| InChIKey | CHBJYYKDEGUWGD-RTWAVKEYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|