C22H23N3O2S — CID 110238205
2-[1-(4,5-dimethylthiophene-2-carbonyl)piperidin-3-yl]quinoline-3-carboxamide (PubChem CID 110238205) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[1-(4,5-dimethylthiophene-2-carbonyl)piperidin-3-yl]quinoline-3-carboxamide.
| Compound Name | 2-[1-(4,5-dimethylthiophene-2-carbonyl)piperidin-3-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110238205 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[1-(4,5-dimethylthiophene-2-carbonyl)piperidin-3-yl]quinoline-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCCC(c3nc4ccccc4cc3C(N)=O)C2)sc1C |
| InChI | InChI=1S/C22H23N3O2S/c1-13-10-19(28-14(13)2)22(27)25-9-5-7-16(12-25)20-17(21(23)26)11-15-6-3-4-8-18(15)24-20/h3-4,6,8,10-11,16H,5,7,9,12H2,1-2H3,(H2,23,26) |
| InChIKey | BKVPCAUYJXBXTO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |