C24H24FN3O4 — CID 110238182
6-fluoro-2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-3-yl]quinoline-3-carboxamide (PubChem CID 110238182) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is 6-fluoro-2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-3-yl]quinoline-3-carboxamide.
| Compound Name | 6-fluoro-2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-3-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110238182 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 6-fluoro-2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-3-yl]quinoline-3-carboxamide |
| SMILES | COc1ccccc1OCC(=O)N1CCCC(c2nc3ccc(F)cc3cc2C(N)=O)C1 |
| InChI | InChI=1S/C24H24FN3O4/c1-31-20-6-2-3-7-21(20)32-14-22(29)28-10-4-5-15(13-28)23-18(24(26)30)12-16-11-17(25)8-9-19(16)27-23/h2-3,6-9,11-12,15H,4-5,10,13-14H2,1H3,(H2,26,30) |
| InChIKey | UBGNJQVYLVMVGH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |