C23H28FN3O2 — CID 110238096
2-[1-(2-cyclohexylacetyl)piperidin-3-yl]-6-fluoroquinoline-3-carboxamide (PubChem CID 110238096) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 2-[1-(2-cyclohexylacetyl)piperidin-3-yl]-6-fluoroquinoline-3-carboxamide.
| Compound Name | 2-[1-(2-cyclohexylacetyl)piperidin-3-yl]-6-fluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110238096 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[1-(2-cyclohexylacetyl)piperidin-3-yl]-6-fluoroquinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2cc(F)ccc2nc1C1CCCN(C(=O)CC2CCCCC2)C1 |
| InChI | InChI=1S/C23H28FN3O2/c24-18-8-9-20-17(12-18)13-19(23(25)29)22(26-20)16-7-4-10-27(14-16)21(28)11-15-5-2-1-3-6-15/h8-9,12-13,15-16H,1-7,10-11,14H2,(H2,25,29) |
| InChIKey | CMTGLISNYRISHV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |