C23H29FN4O — CID 53140070
2-cyclohexyl-1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 53140070) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-cyclohexyl-1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 53140070 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-cyclohexyl-1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCCC(c2ccnc(Nc3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C23H29FN4O/c24-19-9-4-10-20(15-19)26-23-25-12-11-21(27-23)18-8-5-13-28(16-18)22(29)14-17-6-2-1-3-7-17/h4,9-12,15,17-18H,1-3,5-8,13-14,16H2,(H,25,26,27) |
| InChIKey | ZOKKTHLXDNUMRB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |