C21H21FN4OS — CID 53140068
1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 53140068) has the molecular formula C21H21FN4OS and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 53140068 |
| Molecular Formula | C21H21FN4OS |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCCC(c2ccnc(Nc3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C21H21FN4OS/c22-16-5-1-6-17(12-16)24-21-23-9-8-19(25-21)15-4-2-10-26(14-15)20(27)13-18-7-3-11-28-18/h1,3,5-9,11-12,15H,2,4,10,13-14H2,(H,23,24,25) |
| InChIKey | TZNYEGFMIYJVED-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |