C20H19FN4OS — CID 95094666
[(3S)-3-[2-(2-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 95094666) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is [(3S)-3-[2-(2-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3S)-3-[2-(2-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 95094666 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(3S)-3-[2-(2-fluoroanilino)pyrimidin-4-yl]piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC[C@H](c2ccnc(Nc3ccccc3F)n2)C1 |
| InChI | InChI=1S/C20H19FN4OS/c21-15-6-1-2-7-17(15)24-20-22-10-9-16(23-20)14-5-3-11-25(13-14)19(26)18-8-4-12-27-18/h1-2,4,6-10,12,14H,3,5,11,13H2,(H,22,23,24)/t14-/m0/s1 |
| InChIKey | XEYUBWKFUJUODV-AWEZNQCLSA-N |
| XLogP | 4.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |