C22H23N5O — CID 95837440
[(3S)-3-[2-[(3-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperidin-1-yl]-phenylmethanone (PubChem CID 95837440) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is [(3S)-3-[2-[(3-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [(3S)-3-[2-[(3-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 95837440 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [(3S)-3-[2-[(3-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperidin-1-yl]-phenylmethanone |
| SMILES | Cc1cccnc1Nc1nccc([C@H]2CCCN(C(=O)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C22H23N5O/c1-16-7-5-12-23-20(16)26-22-24-13-11-19(25-22)18-10-6-14-27(15-18)21(28)17-8-3-2-4-9-17/h2-5,7-9,11-13,18H,6,10,14-15H2,1H3,(H,23,24,25,26)/t18-/m0/s1 |
| InChIKey | WAMPMFIKOBTRQS-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |