C21H20ClN5O — CID 110267189
(4-chlorophenyl)-[3-[2-(pyridin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone (PubChem CID 110267189) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-[2-(pyridin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-[2-(pyridin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110267189 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (4-chlorophenyl)-[3-[2-(pyridin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC(c2ccnc(Nc3ccccn3)n2)C1 |
| InChI | InChI=1S/C21H20ClN5O/c22-17-8-6-15(7-9-17)20(28)27-13-3-4-16(14-27)18-10-12-24-21(25-18)26-19-5-1-2-11-23-19/h1-2,5-12,16H,3-4,13-14H2,(H,23,24,25,26) |
| InChIKey | OWDQZUMVEYWJDN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |