C22H22ClN5O — CID 95094419
(6-chloro-3-pyridinyl)-[(3R)-3-[2-(3-methylanilino)pyrimidin-4-yl]piperidin-1-yl]methanone (PubChem CID 95094419) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[(3R)-3-[2-(3-methylanilino)pyrimidin-4-yl]piperidin-1-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[(3R)-3-[2-(3-methylanilino)pyrimidin-4-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95094419 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[(3R)-3-[2-(3-methylanilino)pyrimidin-4-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(Nc2nccc([C@@H]3CCCN(C(=O)c4ccc(Cl)nc4)C3)n2)c1 |
| InChI | InChI=1S/C22H22ClN5O/c1-15-4-2-6-18(12-15)26-22-24-10-9-19(27-22)17-5-3-11-28(14-17)21(29)16-7-8-20(23)25-13-16/h2,4,6-10,12-13,17H,3,5,11,14H2,1H3,(H,24,26,27)/t17-/m1/s1 |
| InChIKey | RWVKZFICHXHICI-QGZVFWFLSA-N |
| XLogP | 4.60 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|