C22H23N3OS — CID 95093556
1-[(3S)-3-[2-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 95093556) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-[(3S)-3-[2-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(3S)-3-[2-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 95093556 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[(3S)-3-[2-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | Cc1cccc(-c2nccc([C@H]3CCCN(C(=O)Cc4cccs4)C3)n2)c1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-5-2-6-17(13-16)22-23-10-9-20(24-22)18-7-3-11-25(15-18)21(26)14-19-8-4-12-27-19/h2,4-6,8-10,12-13,18H,3,7,11,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | VODALTYYPZXRPL-SFHVURJKSA-N |
| XLogP | 4.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |