C24H31FN4O2 — CID 110238278
6-fluoro-2-[1-(1-propan-2-ylpiperidine-4-carbonyl)piperidin-3-yl]quinoline-3-carboxamide (PubChem CID 110238278) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 6-fluoro-2-[1-(1-propan-2-ylpiperidine-4-carbonyl)piperidin-3-yl]quinoline-3-carboxamide.
| Compound Name | 6-fluoro-2-[1-(1-propan-2-ylpiperidine-4-carbonyl)piperidin-3-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110238278 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 6-fluoro-2-[1-(1-propan-2-ylpiperidine-4-carbonyl)piperidin-3-yl]quinoline-3-carboxamide |
| SMILES | CC(C)N1CCC(C(=O)N2CCCC(c3nc4ccc(F)cc4cc3C(N)=O)C2)CC1 |
| InChI | InChI=1S/C24H31FN4O2/c1-15(2)28-10-7-16(8-11-28)24(31)29-9-3-4-17(14-29)22-20(23(26)30)13-18-12-19(25)5-6-21(18)27-22/h5-6,12-13,15-17H,3-4,7-11,14H2,1-2H3,(H2,26,30) |
| InChIKey | HWKISDWARJARKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |