C25H26N4O3 — CID 110242901
[2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone (PubChem CID 110242901) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is [2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone.
| Compound Name | [2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone |
|---|---|
| PubChem CID | 110242901 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone |
| SMILES | Cc1ccccc1-c1noc(C2CN(C(=O)c3ccc4c(c3)c(C)c(C)n4C)CCO2)n1 |
| InChI | InChI=1S/C25H26N4O3/c1-15-7-5-6-8-19(15)23-26-24(32-27-23)22-14-29(11-12-31-22)25(30)18-9-10-21-20(13-18)16(2)17(3)28(21)4/h5-10,13,22H,11-12,14H2,1-4H3 |
| InChIKey | CNHIKQQMUNVLTE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|