C25H26N4O4 — CID 92595640
[(2R)-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone (PubChem CID 92595640) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is [(2R)-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone.
| Compound Name | [(2R)-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone |
|---|---|
| PubChem CID | 92595640 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [(2R)-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(1,2,3-trimethylindol-5-yl)methanone |
| SMILES | COc1ccc(-c2noc([C@H]3CN(C(=O)c4ccc5c(c4)c(C)c(C)n5C)CCO3)n2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-15-16(2)28(3)21-10-7-18(13-20(15)21)25(30)29-11-12-32-22(14-29)24-26-23(27-33-24)17-5-8-19(31-4)9-6-17/h5-10,13,22H,11-12,14H2,1-4H3/t22-/m1/s1 |
| InChIKey | RLYRBLUISLBIMO-JOCHJYFZSA-N |
| XLogP | 4.07 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|