C22H22FN3O3S — CID 110242986
[2-[3-[(2-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanone (PubChem CID 110242986) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-[3-[(2-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanone.
| Compound Name | [2-[3-[(2-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 110242986 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-[3-[(2-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]morpholin-4-yl]-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCCC2)N1CCOC(c2nc(Cc3ccccc3F)no2)C1 |
| InChI | InChI=1S/C22H22FN3O3S/c23-16-7-3-1-5-14(16)12-20-24-21(29-25-20)17-13-26(9-10-28-17)22(27)19-11-15-6-2-4-8-18(15)30-19/h1,3,5,7,11,17H,2,4,6,8-10,12-13H2 |
| InChIKey | QKDZNFNNEPBVDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |