C16H14FNO4S — CID 119183971
5-[2-(2-fluorophenyl)morpholine-4-carbonyl]thiophene-2-carboxylic acid (PubChem CID 119183971) has the molecular formula C16H14FNO4S and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-[2-(2-fluorophenyl)morpholine-4-carbonyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-(2-fluorophenyl)morpholine-4-carbonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 119183971 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 5-[2-(2-fluorophenyl)morpholine-4-carbonyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCOC(c3ccccc3F)C2)s1 |
| InChI | InChI=1S/C16H14FNO4S/c17-11-4-2-1-3-10(11)12-9-18(7-8-22-12)15(19)13-5-6-14(23-13)16(20)21/h1-6,12H,7-9H2,(H,20,21) |
| InChIKey | ZVKXPJAEEVTLBB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |