C25H29FN2O2 — CID 110243986
N-cyclopropyl-3-[[3-(3-fluorophenyl)phenyl]methyl]-1-propanoylpiperidine-3-carboxamide (PubChem CID 110243986) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is N-cyclopropyl-3-[[3-(3-fluorophenyl)phenyl]methyl]-1-propanoylpiperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-3-[[3-(3-fluorophenyl)phenyl]methyl]-1-propanoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110243986 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-cyclopropyl-3-[[3-(3-fluorophenyl)phenyl]methyl]-1-propanoylpiperidine-3-carboxamide |
| SMILES | CCC(=O)N1CCCC(Cc2cccc(-c3cccc(F)c3)c2)(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C25H29FN2O2/c1-2-23(29)28-13-5-12-25(17-28,24(30)27-22-10-11-22)16-18-6-3-7-19(14-18)20-8-4-9-21(26)15-20/h3-4,6-9,14-15,22H,2,5,10-13,16-17H2,1H3,(H,27,30) |
| InChIKey | ZEPXINFQSISYGD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |