C25H29FN2O2 — CID 110232836
1-(cyclopentanecarbonyl)-3-[[3-(3-fluorophenyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 110232836) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-(cyclopentanecarbonyl)-3-[[3-(3-fluorophenyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-(cyclopentanecarbonyl)-3-[[3-(3-fluorophenyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110232836 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-(cyclopentanecarbonyl)-3-[[3-(3-fluorophenyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1(Cc2cccc(-c3cccc(F)c3)c2)CCCN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C25H29FN2O2/c26-22-11-4-10-21(15-22)20-9-3-6-18(14-20)16-25(24(27)30)12-5-13-28(17-25)23(29)19-7-1-2-8-19/h3-4,6,9-11,14-15,19H,1-2,5,7-8,12-13,16-17H2,(H2,27,30) |
| InChIKey | IZKCWBNXYSXTCW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |