C21H27ClN4O2 — CID 110245329
ethyl 5-chloro-2-[1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-4-yl]pyridine-3-carboxylate (PubChem CID 110245329) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is ethyl 5-chloro-2-[1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-4-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-2-[1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-4-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 110245329 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 5-chloro-2-[1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidin-4-yl]pyridine-3-carboxylate |
| SMILES | C=CCn1ncc(CN2CCC(c3ncc(Cl)cc3C(=O)OCC)CC2)c1C |
| InChI | InChI=1S/C21H27ClN4O2/c1-4-8-26-15(3)17(12-24-26)14-25-9-6-16(7-10-25)20-19(21(27)28-5-2)11-18(22)13-23-20/h4,11-13,16H,1,5-10,14H2,2-3H3 |
| InChIKey | CLDRPVADBLDEQM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|