C17H27N3O — CID 46953235
2-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 46953235) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 46953235 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | C=CCn1ncc(CN2CCC3(O)CCCCC3C2)c1C |
| InChI | InChI=1S/C17H27N3O/c1-3-9-20-14(2)15(11-18-20)12-19-10-8-17(21)7-5-4-6-16(17)13-19/h3,11,16,21H,1,4-10,12-13H2,2H3 |
| InChIKey | UGDBCOZNPYYOPH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|