C20H29N3O2 — CID 110245846
N-[2-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2-oxoethyl]acetamide (PubChem CID 110245846) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[2-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 110245846 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[2-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCCC[C@@H]2[C@H]1[C@@H](c1ccccc1)CCN2C |
| InChI | InChI=1S/C20H29N3O2/c1-15(24)21-14-19(25)23-12-7-6-10-18-20(23)17(11-13-22(18)2)16-8-4-3-5-9-16/h3-5,8-9,17-18,20H,6-7,10-14H2,1-2H3,(H,21,24)/t17-,18-,20-/m1/s1 |
| InChIKey | DHGXFEKRCDZNLJ-QWFCFKBJSA-N |
| XLogP | 1.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |