C20H30N2O — CID 92586541
1-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]butan-1-one (PubChem CID 92586541) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]butan-1-one.
| Compound Name | 1-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 92586541 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-[(4R,4aR,9aR)-1-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCC[C@@H]2[C@H]1[C@@H](c1ccccc1)CCN2C |
| InChI | InChI=1S/C20H30N2O/c1-3-9-19(23)22-14-8-7-12-18-20(22)17(13-15-21(18)2)16-10-5-4-6-11-16/h4-6,10-11,17-18,20H,3,7-9,12-15H2,1-2H3/t17-,18-,20-/m1/s1 |
| InChIKey | GLEYUGIMDNZXCC-QWFCFKBJSA-N |
| XLogP | 3.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |