C16H20N4O — CID 110246159
5-(4-methoxyphenyl)-4-piperidin-3-ylpyrimidin-2-amine (PubChem CID 110246159) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-piperidin-3-ylpyrimidin-2-amine.
| Compound Name | 5-(4-methoxyphenyl)-4-piperidin-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 110246159 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-piperidin-3-ylpyrimidin-2-amine |
| SMILES | COc1ccc(-c2cnc(N)nc2C2CCCNC2)cc1 |
| InChI | InChI=1S/C16H20N4O/c1-21-13-6-4-11(5-7-13)14-10-19-16(17)20-15(14)12-3-2-8-18-9-12/h4-7,10,12,18H,2-3,8-9H2,1H3,(H2,17,19,20) |
| InChIKey | UOXFTPZSCGGXST-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |