C15H18N4O — CID 95814820
5-(3-methoxyphenyl)-4-[(2R)-pyrrolidin-2-yl]pyrimidin-2-amine (PubChem CID 95814820) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-4-[(2R)-pyrrolidin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-(3-methoxyphenyl)-4-[(2R)-pyrrolidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95814820 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-(3-methoxyphenyl)-4-[(2R)-pyrrolidin-2-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2cnc(N)nc2[C@H]2CCCN2)c1 |
| InChI | InChI=1S/C15H18N4O/c1-20-11-5-2-4-10(8-11)12-9-18-15(16)19-14(12)13-6-3-7-17-13/h2,4-5,8-9,13,17H,3,6-7H2,1H3,(H2,16,18,19)/t13-/m1/s1 |
| InChIKey | INCSHUOKEXLURO-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |