C22H24N6O2 — CID 110248574
N-[1-[2-(4-methyl-2-phenylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]pyridine-2-carboxamide (PubChem CID 110248574) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[1-[2-(4-methyl-2-phenylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]pyridine-2-carboxamide.
| Compound Name | N-[1-[2-(4-methyl-2-phenylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110248574 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[1-[2-(4-methyl-2-phenylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]pyridine-2-carboxamide |
| SMILES | CN1CCN(C(=O)Cn2cc(NC(=O)c3ccccn3)cn2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H24N6O2/c1-26-11-12-28(20(15-26)17-7-3-2-4-8-17)21(29)16-27-14-18(13-24-27)25-22(30)19-9-5-6-10-23-19/h2-10,13-14,20H,11-12,15-16H2,1H3,(H,25,30) |
| InChIKey | IYWTUSYCCAIJOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |