C21H27N5O4 — CID 26324333
ethyl 2-[1-[[2-[4-(pyridine-2-carbonylamino)pyrazol-1-yl]acetyl]amino]cyclohexyl]acetate (PubChem CID 26324333) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethyl 2-[1-[[2-[4-(pyridine-2-carbonylamino)pyrazol-1-yl]acetyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[[2-[4-(pyridine-2-carbonylamino)pyrazol-1-yl]acetyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 26324333 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl 2-[1-[[2-[4-(pyridine-2-carbonylamino)pyrazol-1-yl]acetyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)Cn2cc(NC(=O)c3ccccn3)cn2)CCCCC1 |
| InChI | InChI=1S/C21H27N5O4/c1-2-30-19(28)12-21(9-5-3-6-10-21)25-18(27)15-26-14-16(13-23-26)24-20(29)17-8-4-7-11-22-17/h4,7-8,11,13-14H,2-3,5-6,9-10,12,15H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | JTTUCBPMGQFKEF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |