C17H26N4O3 — CID 154818610
ethyl 2-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)cyclohexyl]acetate (PubChem CID 154818610) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 2-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)cyclohexyl]acetate |
|---|---|
| PubChem CID | 154818610 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | ethyl 2-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)C2CCc3ncnn3C2)CCCCC1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-24-15(22)10-17(8-4-3-5-9-17)20-16(23)13-6-7-14-18-12-19-21(14)11-13/h12-13H,2-11H2,1H3,(H,20,23) |
| InChIKey | ZLFNSGRNPQNNSB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |