C22H22N4O2S — CID 110249773
3-[6-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-2-pyridinyl]benzamide (PubChem CID 110249773) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[6-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-2-pyridinyl]benzamide.
| Compound Name | 3-[6-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 110249773 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[6-[1-(4-methyl-1,3-thiazole-5-carbonyl)piperidin-3-yl]-2-pyridinyl]benzamide |
| SMILES | Cc1ncsc1C(=O)N1CCCC(c2cccc(-c3cccc(C(N)=O)c3)n2)C1 |
| InChI | InChI=1S/C22H22N4O2S/c1-14-20(29-13-24-14)22(28)26-10-4-7-17(12-26)19-9-3-8-18(25-19)15-5-2-6-16(11-15)21(23)27/h2-3,5-6,8-9,11,13,17H,4,7,10,12H2,1H3,(H2,23,27) |
| InChIKey | CNVAHPVDGMNHHZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |