C23H30N2O3S — CID 110251137
3-[1-(2-cyclopentylacetyl)pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 110251137) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is 3-[1-(2-cyclopentylacetyl)pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[1-(2-cyclopentylacetyl)pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110251137 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[1-(2-cyclopentylacetyl)pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2ccccc2c1C1CCN(C(=O)CC2CCCC2)C1 |
| InChI | InChI=1S/C23H30N2O3S/c1-28-13-11-24-23(27)22-21(18-8-4-5-9-19(18)29-22)17-10-12-25(15-17)20(26)14-16-6-2-3-7-16/h4-5,8-9,16-17H,2-3,6-7,10-15H2,1H3,(H,24,27) |
| InChIKey | ZZOCUPJJLFDRIX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|