C24H25FN2O3S — CID 95812712
3-[(3R)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 95812712) has the molecular formula C24H25FN2O3S and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[(3R)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[(3R)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95812712 |
| Molecular Formula | C24H25FN2O3S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 3-[(3R)-1-[2-(3-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2ccccc2c1[C@H]1CCN(C(=O)Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H25FN2O3S/c1-30-12-10-26-24(29)23-22(19-7-2-3-8-20(19)31-23)17-9-11-27(15-17)21(28)14-16-5-4-6-18(25)13-16/h2-8,13,17H,9-12,14-15H2,1H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | JVWRKEYWWVEIRH-KRWDZBQOSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|