C24H21ClN4O2 — CID 110251401
2-[1-(5-chloro-1-methylindole-2-carbonyl)pyrrolidin-3-yl]quinoline-4-carboxamide (PubChem CID 110251401) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[1-(5-chloro-1-methylindole-2-carbonyl)pyrrolidin-3-yl]quinoline-4-carboxamide.
| Compound Name | 2-[1-(5-chloro-1-methylindole-2-carbonyl)pyrrolidin-3-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 110251401 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[1-(5-chloro-1-methylindole-2-carbonyl)pyrrolidin-3-yl]quinoline-4-carboxamide |
| SMILES | Cn1c(C(=O)N2CCC(c3cc(C(N)=O)c4ccccc4n3)C2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H21ClN4O2/c1-28-21-7-6-16(25)10-15(21)11-22(28)24(31)29-9-8-14(13-29)20-12-18(23(26)30)17-4-2-3-5-19(17)27-20/h2-7,10-12,14H,8-9,13H2,1H3,(H2,26,30) |
| InChIKey | HATCXAVCPIYHHE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |