C15H19N5O2S — CID 110252903
6-(1-methylsulfonylpiperidin-3-yl)-N-pyridin-2-ylpyrazin-2-amine (PubChem CID 110252903) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 6-(1-methylsulfonylpiperidin-3-yl)-N-pyridin-2-ylpyrazin-2-amine.
| Compound Name | 6-(1-methylsulfonylpiperidin-3-yl)-N-pyridin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 110252903 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 6-(1-methylsulfonylpiperidin-3-yl)-N-pyridin-2-ylpyrazin-2-amine |
| SMILES | CS(=O)(=O)N1CCCC(c2cncc(Nc3ccccn3)n2)C1 |
| InChI | InChI=1S/C15H19N5O2S/c1-23(21,22)20-8-4-5-12(11-20)13-9-16-10-15(18-13)19-14-6-2-3-7-17-14/h2-3,6-7,9-10,12H,4-5,8,11H2,1H3,(H,17,18,19) |
| InChIKey | DQLUETODJNFDHX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |