C16H19N3O3S — CID 95822186
2-[(3R)-1-methylsulfonylpiperidin-3-yl]-6-phenoxypyrazine (PubChem CID 95822186) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[(3R)-1-methylsulfonylpiperidin-3-yl]-6-phenoxypyrazine.
| Compound Name | 2-[(3R)-1-methylsulfonylpiperidin-3-yl]-6-phenoxypyrazine |
|---|---|
| PubChem CID | 95822186 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[(3R)-1-methylsulfonylpiperidin-3-yl]-6-phenoxypyrazine |
| SMILES | CS(=O)(=O)N1CCC[C@@H](c2cncc(Oc3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H19N3O3S/c1-23(20,21)19-9-5-6-13(12-19)15-10-17-11-16(18-15)22-14-7-3-2-4-8-14/h2-4,7-8,10-11,13H,5-6,9,12H2,1H3/t13-/m1/s1 |
| InChIKey | VIMJVQAQJMSJQI-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |