C14H20N4O4S — CID 110253411
[2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 110253411) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is [2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110253411 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCOC(C)(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C14H20N4O4S/c1-10-11(23-16-15-10)12(19)18-5-8-22-14(2,9-18)13(20)17-3-6-21-7-4-17/h3-9H2,1-2H3 |
| InChIKey | BVTAOGRPZPZFAA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |