C10H13N3O4S — CID 66420176
2-[4-(4-methylthiadiazole-5-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 66420176) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[4-(4-methylthiadiazole-5-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(4-methylthiadiazole-5-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66420176 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[4-(4-methylthiadiazole-5-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | Cc1nnsc1C(=O)N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C10H13N3O4S/c1-6-9(18-12-11-6)10(16)13-2-3-17-7(5-13)4-8(14)15/h7H,2-5H2,1H3,(H,14,15) |
| InChIKey | QMDKJLWNTUZCOS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |