C23H25N3O2S — CID 110253769
morpholin-4-yl-[3-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone (PubChem CID 110253769) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is morpholin-4-yl-[3-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone.
| Compound Name | morpholin-4-yl-[3-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 110253769 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | morpholin-4-yl-[3-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone |
| SMILES | O=C(c1sc2ccccc2c1C1CCN(Cc2ccncc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C23H25N3O2S/c27-23(26-11-13-28-14-12-26)22-21(19-3-1-2-4-20(19)29-22)18-7-10-25(16-18)15-17-5-8-24-9-6-17/h1-6,8-9,18H,7,10-16H2 |
| InChIKey | BKSBNNTYUGSTKF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |