C21H22N4O2S — CID 95816295
morpholin-4-yl-[3-[(3R)-1-pyrazin-2-ylpyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone (PubChem CID 95816295) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is morpholin-4-yl-[3-[(3R)-1-pyrazin-2-ylpyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone.
| Compound Name | morpholin-4-yl-[3-[(3R)-1-pyrazin-2-ylpyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 95816295 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | morpholin-4-yl-[3-[(3R)-1-pyrazin-2-ylpyrrolidin-3-yl]-1-benzothiophen-2-yl]methanone |
| SMILES | O=C(c1sc2ccccc2c1[C@H]1CCN(c2cnccn2)C1)N1CCOCC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-21(24-9-11-27-12-10-24)20-19(16-3-1-2-4-17(16)28-20)15-5-8-25(14-15)18-13-22-6-7-23-18/h1-4,6-7,13,15H,5,8-12,14H2/t15-/m0/s1 |
| InChIKey | MPWNHJRRWCGMLT-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |