C19H11F2N3O4 — CID 11025383
3-[[3,5-difluoro-4-methyl-6-(3-nitrophenoxy)-2-pyridinyl]oxy]benzonitrile (PubChem CID 11025383) has the molecular formula C19H11F2N3O4 and a molecular weight of 383.31 g/mol. Its IUPAC name is 3-[[3,5-difluoro-4-methyl-6-(3-nitrophenoxy)-2-pyridinyl]oxy]benzonitrile.
| Compound Name | 3-[[3,5-difluoro-4-methyl-6-(3-nitrophenoxy)-2-pyridinyl]oxy]benzonitrile |
|---|---|
| PubChem CID | 11025383 |
| Molecular Formula | C19H11F2N3O4 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-[[3,5-difluoro-4-methyl-6-(3-nitrophenoxy)-2-pyridinyl]oxy]benzonitrile |
| SMILES | Cc1c(F)c(Oc2cccc(C#N)c2)nc(Oc2cccc([N+](=O)[O-])c2)c1F |
| InChI | InChI=1S/C19H11F2N3O4/c1-11-16(20)18(27-14-6-2-4-12(8-14)10-22)23-19(17(11)21)28-15-7-3-5-13(9-15)24(25)26/h2-9H,1H3 |
| InChIKey | SWTVEGGAPNANDW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|