C13H7F3N2O — CID 10611771
3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)oxy](13C,15N)benzonitrile (PubChem CID 10611771) has the molecular formula C13H7F3N2O and a molecular weight of 266.19 g/mol. Its IUPAC name is 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)oxy](13C,15N)benzonitrile.
| Compound Name | 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)oxy](13C,15N)benzonitrile |
|---|---|
| PubChem CID | 10611771 |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)oxy](13C,15N)benzonitrile |
| SMILES | Cc1c(F)c(F)nc(Oc2cccc([13C]#[15N])c2)c1F |
| InChI | InChI=1S/C13H7F3N2O/c1-7-10(14)12(16)18-13(11(7)15)19-9-4-2-3-8(5-9)6-17/h2-5H,1H3/i6+1,17+1 |
| InChIKey | HQCRTGJPGZVNFT-IDWUVPRBSA-N |
| XLogP | 3.47 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|