C14H10F3N3 — CID 23441991
3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)methylamino]benzonitrile (PubChem CID 23441991) has the molecular formula C14H10F3N3 and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)methylamino]benzonitrile.
| Compound Name | 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 23441991 |
| Molecular Formula | C14H10F3N3 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-[(3,5,6-trifluoro-4-methyl-2-pyridinyl)methylamino]benzonitrile |
| SMILES | Cc1c(F)c(F)nc(CNc2cccc(C#N)c2)c1F |
| InChI | InChI=1S/C14H10F3N3/c1-8-12(15)11(20-14(17)13(8)16)7-19-10-4-2-3-9(5-10)6-18/h2-5,19H,7H2,1H3 |
| InChIKey | ZELNJHCKPIZCMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|