C12H16F3N3O2S — CID 110254116
2-methyl-4-(1-methylsulfonylpiperidin-3-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 110254116) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-methyl-4-(1-methylsulfonylpiperidin-3-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-methyl-4-(1-methylsulfonylpiperidin-3-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 110254116 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-methyl-4-(1-methylsulfonylpiperidin-3-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nc(C2CCCN(S(C)(=O)=O)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N3O2S/c1-8-16-10(6-11(17-8)12(13,14)15)9-4-3-5-18(7-9)21(2,19)20/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | OLKVYKBGHXHTAE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |