C13H16F3N3O2 — CID 124950305
2-hydroxy-1-[(3R)-3-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 124950305) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-hydroxy-1-[(3R)-3-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(3R)-3-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124950305 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-hydroxy-1-[(3R)-3-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | Cc1nc([C@@H]2CCCN(C(=O)CO)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-8-17-10(5-11(18-8)13(14,15)16)9-3-2-4-19(6-9)12(21)7-20/h5,9,20H,2-4,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | DAVNLNZRLJISLG-SECBINFHSA-N |
| XLogP | 1.50 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |