C22H22FN3O2S — CID 110255013
2-(1-benzylsulfonylpiperidin-3-yl)-3-(2-fluorophenyl)pyrazine (PubChem CID 110255013) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-(1-benzylsulfonylpiperidin-3-yl)-3-(2-fluorophenyl)pyrazine.
| Compound Name | 2-(1-benzylsulfonylpiperidin-3-yl)-3-(2-fluorophenyl)pyrazine |
|---|---|
| PubChem CID | 110255013 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(1-benzylsulfonylpiperidin-3-yl)-3-(2-fluorophenyl)pyrazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCC(c2nccnc2-c2ccccc2F)C1 |
| InChI | InChI=1S/C22H22FN3O2S/c23-20-11-5-4-10-19(20)22-21(24-12-13-25-22)18-9-6-14-26(15-18)29(27,28)16-17-7-2-1-3-8-17/h1-5,7-8,10-13,18H,6,9,14-16H2 |
| InChIKey | BWDAVHWUAWPFFR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |