C20H25N3O3 — CID 110256428
3-methoxy-1-[3-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 110256428) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-methoxy-1-[3-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-methoxy-1-[3-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110256428 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-methoxy-1-[3-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | COCCC(=O)N1CCCC(c2nccnc2Oc2cccc(C)c2)C1 |
| InChI | InChI=1S/C20H25N3O3/c1-15-5-3-7-17(13-15)26-20-19(21-9-10-22-20)16-6-4-11-23(14-16)18(24)8-12-25-2/h3,5,7,9-10,13,16H,4,6,8,11-12,14H2,1-2H3 |
| InChIKey | ZGRIVQYFHGQJNC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |